C11H18N4O — CID 104924238
N-[2-(cyclopropylmethoxy)ethyl]-5,6-dimethyl-1,2,4-triazin-3-amine (PubChem CID 104924238) has the molecular formula C11H18N4O and a molecular weight of 222.29 g/mol. Its IUPAC name is N-[2-(cyclopropylmethoxy)ethyl]-5,6-dimethyl-1,2,4-triazin-3-amine.
| Compound Name | N-[2-(cyclopropylmethoxy)ethyl]-5,6-dimethyl-1,2,4-triazin-3-amine |
|---|---|
| PubChem CID | 104924238 |
| Molecular Formula | C11H18N4O |
| Molecular Weight | 222.29 g/mol |
| Exact Mass | 222.15 |
| IUPAC Name | N-[2-(cyclopropylmethoxy)ethyl]-5,6-dimethyl-1,2,4-triazin-3-amine |
| SMILES | Cc1nnc(NCCOCC2CC2)nc1C |
| InChI | InChI=1S/C11H18N4O/c1-8-9(2)14-15-11(13-8)12-5-6-16-7-10-3-4-10/h10H,3-7H2,1-2H3,(H,12,13,15) |
| InChIKey | JNDUWBRQBVZPIO-UHFFFAOYSA-N |
| XLogP | 1.33 |
| TPSA | 59.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 222.29 |
| LogP ≤ 5 | 1.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|