C18H24O2 — CID 10492428
[(2R,6aS)-1-(hydroxymethyl)-5,5-dimethyl-2-phenyl-2,3,6,6a-tetrahydropentalen-1-yl]methanol (PubChem CID 10492428) has the molecular formula C18H24O2 and a molecular weight of 272.39 g/mol. Its IUPAC name is [(2R,6aS)-1-(hydroxymethyl)-5,5-dimethyl-2-phenyl-2,3,6,6a-tetrahydropentalen-1-yl]methanol.
| Compound Name | [(2R,6aS)-1-(hydroxymethyl)-5,5-dimethyl-2-phenyl-2,3,6,6a-tetrahydropentalen-1-yl]methanol |
|---|---|
| PubChem CID | 10492428 |
| Molecular Formula | C18H24O2 |
| Molecular Weight | 272.39 g/mol |
| Exact Mass | 272.18 |
| IUPAC Name | [(2R,6aS)-1-(hydroxymethyl)-5,5-dimethyl-2-phenyl-2,3,6,6a-tetrahydropentalen-1-yl]methanol |
| SMILES | CC1(C)C=C2C[C@H](c3ccccc3)C(CO)(CO)[C@H]2C1 |
| InChI | InChI=1S/C18H24O2/c1-17(2)9-14-8-15(13-6-4-3-5-7-13)18(11-19,12-20)16(14)10-17/h3-7,9,15-16,19-20H,8,10-12H2,1-2H3/t15-,16+/m1/s1 |
| InChIKey | FMLDOZOWJNGVDI-CVEARBPZSA-N |
| XLogP | 3.12 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.39 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|