C10H14N4S — CID 104924411
5,6-dimethyl-N-(2-prop-2-ynylsulfanylethyl)-1,2,4-triazin-3-amine (PubChem CID 104924411) has the molecular formula C10H14N4S and a molecular weight of 222.32 g/mol. Its IUPAC name is 5,6-dimethyl-N-(2-prop-2-ynylsulfanylethyl)-1,2,4-triazin-3-amine.
| Compound Name | 5,6-dimethyl-N-(2-prop-2-ynylsulfanylethyl)-1,2,4-triazin-3-amine |
|---|---|
| PubChem CID | 104924411 |
| Molecular Formula | C10H14N4S |
| Molecular Weight | 222.32 g/mol |
| Exact Mass | 222.09 |
| IUPAC Name | 5,6-dimethyl-N-(2-prop-2-ynylsulfanylethyl)-1,2,4-triazin-3-amine |
| SMILES | C#CCSCCNc1nnc(C)c(C)n1 |
| InChI | InChI=1S/C10H14N4S/c1-4-6-15-7-5-11-10-12-8(2)9(3)13-14-10/h1H,5-7H2,2-3H3,(H,11,12,14) |
| InChIKey | AYCJKZRHKMOMLX-UHFFFAOYSA-N |
| XLogP | 1.27 |
| TPSA | 50.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 222.32 |
| LogP ≤ 5 | 1.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|