C9H14N4S — CID 104924497
5,6-dimethyl-N-(thiolan-3-yl)-1,2,4-triazin-3-amine (PubChem CID 104924497) has the molecular formula C9H14N4S and a molecular weight of 210.31 g/mol. Its IUPAC name is 5,6-dimethyl-N-(thiolan-3-yl)-1,2,4-triazin-3-amine.
| Compound Name | 5,6-dimethyl-N-(thiolan-3-yl)-1,2,4-triazin-3-amine |
|---|---|
| PubChem CID | 104924497 |
| Molecular Formula | C9H14N4S |
| Molecular Weight | 210.31 g/mol |
| Exact Mass | 210.09 |
| IUPAC Name | 5,6-dimethyl-N-(thiolan-3-yl)-1,2,4-triazin-3-amine |
| SMILES | Cc1nnc(NC2CCSC2)nc1C |
| InChI | InChI=1S/C9H14N4S/c1-6-7(2)12-13-9(10-6)11-8-3-4-14-5-8/h8H,3-5H2,1-2H3,(H,10,11,13) |
| InChIKey | KGFLGTMRZCUPSD-UHFFFAOYSA-N |
| XLogP | 1.41 |
| TPSA | 50.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 210.31 |
| LogP ≤ 5 | 1.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |