C12H16BrFN2 — CID 104924733
5-bromo-3-fluoro-2-(3-propan-2-ylpyrrolidin-1-yl)pyridine (PubChem CID 104924733) has the molecular formula C12H16BrFN2 and a molecular weight of 287.18 g/mol. Its IUPAC name is 5-bromo-3-fluoro-2-(3-propan-2-ylpyrrolidin-1-yl)pyridine.
| Compound Name | 5-bromo-3-fluoro-2-(3-propan-2-ylpyrrolidin-1-yl)pyridine |
|---|---|
| PubChem CID | 104924733 |
| Molecular Formula | C12H16BrFN2 |
| Molecular Weight | 287.18 g/mol |
| Exact Mass | 286.05 |
| IUPAC Name | 5-bromo-3-fluoro-2-(3-propan-2-ylpyrrolidin-1-yl)pyridine |
| SMILES | CC(C)C1CCN(c2ncc(Br)cc2F)C1 |
| InChI | InChI=1S/C12H16BrFN2/c1-8(2)9-3-4-16(7-9)12-11(14)5-10(13)6-15-12/h5-6,8-9H,3-4,7H2,1-2H3 |
| InChIKey | BZWRHYWEGQDYKK-UHFFFAOYSA-N |
| XLogP | 3.47 |
| TPSA | 16.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.18 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |