About 4-[(2-methylpyrazolo[1,5-a]pyrazin-4-yl)amino]cyclohexan-1-ol
4-[(2-methylpyrazolo[1,5-a]pyrazin-4-yl)amino]cyclohexan-1-ol (PubChem CID 104925008) has the molecular formula C13H18N4O
and a molecular weight of 246.31 g/mol. Its IUPAC name is 4-[(2-methylpyrazolo[1,5-a]pyrazin-4-yl)amino]cyclohexan-1-ol.
Molecular Properties
| Compound Name | 4-[(2-methylpyrazolo[1,5-a]pyrazin-4-yl)amino]cyclohexan-1-ol |
| PubChem CID | 104925008 |
| Molecular Formula | C13H18N4O |
| Molecular Weight | 246.31 g/mol |
| Exact Mass | 246.15 |
| IUPAC Name | 4-[(2-methylpyrazolo[1,5-a]pyrazin-4-yl)amino]cyclohexan-1-ol |
| SMILES | Cc1cc2c(NC3CCC(O)CC3)nccn2n1 |
| InChI | InChI=1S/C13H18N4O/c1-9-8-12-13(14-6-7-17(12)16-9)15-10-2-4-11(18)5-3-10/h6-8,10-11,18H,2-5H2,1H3,(H,14,15) |
| InChIKey | BUNALAAPICKVOB-UHFFFAOYSA-N |
| XLogP | 1.75 |
| TPSA | 62.45 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 246.31 |
| LogP ≤ 5 | 1.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 4-[(2-methylpyrazolo[1,5-a]pyrazin-4-yl)amino]cyclohexan-1-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[(2-methylpyrazolo[1,5-a]pyrazin-4-yl)amino]cyclohexan-1-ol?
The IUPAC name of 4-[(2-methylpyrazolo[1,5-a]pyrazin-4-yl)amino]cyclohexan-1-ol (CID 104925008) is 4-[(2-methylpyrazolo[1,5-a]pyrazin-4-yl)amino]cyclohexan-1-ol.
What is the SMILES notation for 4-[(2-methylpyrazolo[1,5-a]pyrazin-4-yl)amino]cyclohexan-1-ol?
The canonical SMILES for 4-[(2-methylpyrazolo[1,5-a]pyrazin-4-yl)amino]cyclohexan-1-ol is Cc1cc2c(NC3CCC(O)CC3)nccn2n1.
What is the InChIKey of 4-[(2-methylpyrazolo[1,5-a]pyrazin-4-yl)amino]cyclohexan-1-ol?
The InChIKey is BUNALAAPICKVOB-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H18N4O/c1-9-8-12-13(14-6-7-17(12)16-9)15-10-2-4-11(18)5-3-10/h6-8,10-11,18H,2-5H2,1H3,(H,14,15).
What are the key properties of 4-[(2-methylpyrazolo[1,5-a]pyrazin-4-yl)amino]cyclohexan-1-ol?
4-[(2-methylpyrazolo[1,5-a]pyrazin-4-yl)amino]cyclohexan-1-ol has a molecular weight of 246.31 g/mol, XLogP of 1.75, 2 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[(2-methylpyrazolo[1,5-a]pyrazin-4-yl)amino]cyclohexan-1-ol is sourced from PubChem (CID 104925008), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).