C11H18ClN3S — CID 104925205
6-chloro-2-N-methyl-2-N-(1-methylsulfanylbutan-2-yl)pyridine-2,4-diamine (PubChem CID 104925205) has the molecular formula C11H18ClN3S and a molecular weight of 259.81 g/mol. Its IUPAC name is 6-chloro-2-N-methyl-2-N-(1-methylsulfanylbutan-2-yl)pyridine-2,4-diamine.
| Compound Name | 6-chloro-2-N-methyl-2-N-(1-methylsulfanylbutan-2-yl)pyridine-2,4-diamine |
|---|---|
| PubChem CID | 104925205 |
| Molecular Formula | C11H18ClN3S |
| Molecular Weight | 259.81 g/mol |
| Exact Mass | 259.09 |
| IUPAC Name | 6-chloro-2-N-methyl-2-N-(1-methylsulfanylbutan-2-yl)pyridine-2,4-diamine |
| SMILES | CCC(CSC)N(C)c1cc(N)cc(Cl)n1 |
| InChI | InChI=1S/C11H18ClN3S/c1-4-9(7-16-3)15(2)11-6-8(13)5-10(12)14-11/h5-6,9H,4,7H2,1-3H3,(H2,13,14) |
| InChIKey | CATISKTWHVXKPK-UHFFFAOYSA-N |
| XLogP | 2.89 |
| TPSA | 42.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.81 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|