About 3-[(6,6,6-trifluorohexan-2-ylamino)methyl]oxolan-3-ol
3-[(6,6,6-trifluorohexan-2-ylamino)methyl]oxolan-3-ol (PubChem CID 104925234) has the molecular formula C11H20F3NO2
and a molecular weight of 255.28 g/mol. Its IUPAC name is 3-[(6,6,6-trifluorohexan-2-ylamino)methyl]oxolan-3-ol.
Molecular Properties
| Compound Name | 3-[(6,6,6-trifluorohexan-2-ylamino)methyl]oxolan-3-ol |
| PubChem CID | 104925234 |
| Molecular Formula | C11H20F3NO2 |
| Molecular Weight | 255.28 g/mol |
| Exact Mass | 255.14 |
| IUPAC Name | 3-[(6,6,6-trifluorohexan-2-ylamino)methyl]oxolan-3-ol |
| SMILES | CC(CCCC(F)(F)F)NCC1(O)CCOC1 |
| InChI | InChI=1S/C11H20F3NO2/c1-9(3-2-4-11(12,13)14)15-7-10(16)5-6-17-8-10/h9,15-16H,2-8H2,1H3 |
| InChIKey | DFICKPXQEXWTPD-UHFFFAOYSA-N |
| XLogP | 1.85 |
| TPSA | 41.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 255.28 |
| LogP ≤ 5 | 1.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 3-[(6,6,6-trifluorohexan-2-ylamino)methyl]oxolan-3-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[(6,6,6-trifluorohexan-2-ylamino)methyl]oxolan-3-ol?
The IUPAC name of 3-[(6,6,6-trifluorohexan-2-ylamino)methyl]oxolan-3-ol (CID 104925234) is 3-[(6,6,6-trifluorohexan-2-ylamino)methyl]oxolan-3-ol.
What is the SMILES notation for 3-[(6,6,6-trifluorohexan-2-ylamino)methyl]oxolan-3-ol?
The canonical SMILES for 3-[(6,6,6-trifluorohexan-2-ylamino)methyl]oxolan-3-ol is CC(CCCC(F)(F)F)NCC1(O)CCOC1.
What is the InChIKey of 3-[(6,6,6-trifluorohexan-2-ylamino)methyl]oxolan-3-ol?
The InChIKey is DFICKPXQEXWTPD-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H20F3NO2/c1-9(3-2-4-11(12,13)14)15-7-10(16)5-6-17-8-10/h9,15-16H,2-8H2,1H3.
What are the key properties of 3-[(6,6,6-trifluorohexan-2-ylamino)methyl]oxolan-3-ol?
3-[(6,6,6-trifluorohexan-2-ylamino)methyl]oxolan-3-ol has a molecular weight of 255.28 g/mol, XLogP of 1.85, 6 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[(6,6,6-trifluorohexan-2-ylamino)methyl]oxolan-3-ol is sourced from PubChem (CID 104925234), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).