C12H22N4S — CID 104925329
5,6-dimethyl-N-(6-methylsulfanylhexyl)-1,2,4-triazin-3-amine (PubChem CID 104925329) has the molecular formula C12H22N4S and a molecular weight of 254.40 g/mol. Its IUPAC name is 5,6-dimethyl-N-(6-methylsulfanylhexyl)-1,2,4-triazin-3-amine.
| Compound Name | 5,6-dimethyl-N-(6-methylsulfanylhexyl)-1,2,4-triazin-3-amine |
|---|---|
| PubChem CID | 104925329 |
| Molecular Formula | C12H22N4S |
| Molecular Weight | 254.40 g/mol |
| Exact Mass | 254.16 |
| IUPAC Name | 5,6-dimethyl-N-(6-methylsulfanylhexyl)-1,2,4-triazin-3-amine |
| SMILES | CSCCCCCCNc1nnc(C)c(C)n1 |
| InChI | InChI=1S/C12H22N4S/c1-10-11(2)15-16-12(14-10)13-8-6-4-5-7-9-17-3/h4-9H2,1-3H3,(H,13,14,16) |
| InChIKey | HJCLORZDWAOREV-UHFFFAOYSA-N |
| XLogP | 2.82 |
| TPSA | 50.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.40 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|