About 6-chloro-2-N-(2,3-dihydro-1H-inden-2-yl)pyridine-2,4-diamine
6-chloro-2-N-(2,3-dihydro-1H-inden-2-yl)pyridine-2,4-diamine (PubChem CID 104925398) has the molecular formula C14H14ClN3
and a molecular weight of 259.74 g/mol. Its IUPAC name is 6-chloro-2-N-(2,3-dihydro-1H-inden-2-yl)pyridine-2,4-diamine.
Molecular Properties
| Compound Name | 6-chloro-2-N-(2,3-dihydro-1H-inden-2-yl)pyridine-2,4-diamine |
| PubChem CID | 104925398 |
| Molecular Formula | C14H14ClN3 |
| Molecular Weight | 259.74 g/mol |
| Exact Mass | 259.09 |
| IUPAC Name | 6-chloro-2-N-(2,3-dihydro-1H-inden-2-yl)pyridine-2,4-diamine |
| SMILES | Nc1cc(Cl)nc(NC2Cc3ccccc3C2)c1 |
| InChI | InChI=1S/C14H14ClN3/c15-13-7-11(16)8-14(18-13)17-12-5-9-3-1-2-4-10(9)6-12/h1-4,7-8,12H,5-6H2,(H3,16,17,18) |
| InChIKey | SVGSQLJSYKFEAU-UHFFFAOYSA-N |
| XLogP | 2.90 |
| TPSA | 50.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 259.74 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|
Analyze 6-chloro-2-N-(2,3-dihydro-1H-inden-2-yl)pyridine-2,4-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-chloro-2-N-(2,3-dihydro-1H-inden-2-yl)pyridine-2,4-diamine?
The IUPAC name of 6-chloro-2-N-(2,3-dihydro-1H-inden-2-yl)pyridine-2,4-diamine (CID 104925398) is 6-chloro-2-N-(2,3-dihydro-1H-inden-2-yl)pyridine-2,4-diamine.
What is the SMILES notation for 6-chloro-2-N-(2,3-dihydro-1H-inden-2-yl)pyridine-2,4-diamine?
The canonical SMILES for 6-chloro-2-N-(2,3-dihydro-1H-inden-2-yl)pyridine-2,4-diamine is Nc1cc(Cl)nc(NC2Cc3ccccc3C2)c1.
What is the InChIKey of 6-chloro-2-N-(2,3-dihydro-1H-inden-2-yl)pyridine-2,4-diamine?
The InChIKey is SVGSQLJSYKFEAU-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H14ClN3/c15-13-7-11(16)8-14(18-13)17-12-5-9-3-1-2-4-10(9)6-12/h1-4,7-8,12H,5-6H2,(H3,16,17,18).
What are the key properties of 6-chloro-2-N-(2,3-dihydro-1H-inden-2-yl)pyridine-2,4-diamine?
6-chloro-2-N-(2,3-dihydro-1H-inden-2-yl)pyridine-2,4-diamine has a molecular weight of 259.74 g/mol, XLogP of 2.90, 2 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 6-chloro-2-N-(2,3-dihydro-1H-inden-2-yl)pyridine-2,4-diamine is sourced from PubChem (CID 104925398), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).