C11H20N4S — CID 104925499
5,6-dimethyl-N-(5-methylsulfanylpentyl)-1,2,4-triazin-3-amine (PubChem CID 104925499) has the molecular formula C11H20N4S and a molecular weight of 240.38 g/mol. Its IUPAC name is 5,6-dimethyl-N-(5-methylsulfanylpentyl)-1,2,4-triazin-3-amine.
| Compound Name | 5,6-dimethyl-N-(5-methylsulfanylpentyl)-1,2,4-triazin-3-amine |
|---|---|
| PubChem CID | 104925499 |
| Molecular Formula | C11H20N4S |
| Molecular Weight | 240.38 g/mol |
| Exact Mass | 240.14 |
| IUPAC Name | 5,6-dimethyl-N-(5-methylsulfanylpentyl)-1,2,4-triazin-3-amine |
| SMILES | CSCCCCCNc1nnc(C)c(C)n1 |
| InChI | InChI=1S/C11H20N4S/c1-9-10(2)14-15-11(13-9)12-7-5-4-6-8-16-3/h4-8H2,1-3H3,(H,12,13,15) |
| InChIKey | GHIUFPSXXDOAHQ-UHFFFAOYSA-N |
| XLogP | 2.43 |
| TPSA | 50.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.38 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|