C11H19N5O — CID 104925840
2-[[2-(dimethylamino)pyrimidin-4-yl]amino]-N-ethyl-N-methylacetamide (PubChem CID 104925840) has the molecular formula C11H19N5O and a molecular weight of 237.31 g/mol. Its IUPAC name is 2-[[2-(dimethylamino)pyrimidin-4-yl]amino]-N-ethyl-N-methylacetamide.
| Compound Name | 2-[[2-(dimethylamino)pyrimidin-4-yl]amino]-N-ethyl-N-methylacetamide |
|---|---|
| PubChem CID | 104925840 |
| Molecular Formula | C11H19N5O |
| Molecular Weight | 237.31 g/mol |
| Exact Mass | 237.16 |
| IUPAC Name | 2-[[2-(dimethylamino)pyrimidin-4-yl]amino]-N-ethyl-N-methylacetamide |
| SMILES | CCN(C)C(=O)CNc1ccnc(N(C)C)n1 |
| InChI | InChI=1S/C11H19N5O/c1-5-16(4)10(17)8-13-9-6-7-12-11(14-9)15(2)3/h6-7H,5,8H2,1-4H3,(H,12,13,14) |
| InChIKey | GJHKHIYAGUMEIM-UHFFFAOYSA-N |
| XLogP | 0.43 |
| TPSA | 61.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 237.31 |
| LogP ≤ 5 | 0.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |