About 3-(hex-5-en-2-ylamino)-4,4-dimethylpentan-1-ol
3-(hex-5-en-2-ylamino)-4,4-dimethylpentan-1-ol (PubChem CID 104925900) has the molecular formula C13H27NO
and a molecular weight of 213.36 g/mol. Its IUPAC name is 3-(hex-5-en-2-ylamino)-4,4-dimethylpentan-1-ol.
Molecular Properties
| Compound Name | 3-(hex-5-en-2-ylamino)-4,4-dimethylpentan-1-ol |
| PubChem CID | 104925900 |
| Molecular Formula | C13H27NO |
| Molecular Weight | 213.36 g/mol |
| Exact Mass | 213.21 |
| IUPAC Name | 3-(hex-5-en-2-ylamino)-4,4-dimethylpentan-1-ol |
| SMILES | C=CCCC(C)NC(CCO)C(C)(C)C |
| InChI | InChI=1S/C13H27NO/c1-6-7-8-11(2)14-12(9-10-15)13(3,4)5/h6,11-12,14-15H,1,7-10H2,2-5H3 |
| InChIKey | KOQDKDZTDFFPJX-UHFFFAOYSA-N |
| XLogP | 2.73 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 213.36 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 3-(hex-5-en-2-ylamino)-4,4-dimethylpentan-1-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(hex-5-en-2-ylamino)-4,4-dimethylpentan-1-ol?
The IUPAC name of 3-(hex-5-en-2-ylamino)-4,4-dimethylpentan-1-ol (CID 104925900) is 3-(hex-5-en-2-ylamino)-4,4-dimethylpentan-1-ol.
What is the SMILES notation for 3-(hex-5-en-2-ylamino)-4,4-dimethylpentan-1-ol?
The canonical SMILES for 3-(hex-5-en-2-ylamino)-4,4-dimethylpentan-1-ol is C=CCCC(C)NC(CCO)C(C)(C)C.
What is the InChIKey of 3-(hex-5-en-2-ylamino)-4,4-dimethylpentan-1-ol?
The InChIKey is KOQDKDZTDFFPJX-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H27NO/c1-6-7-8-11(2)14-12(9-10-15)13(3,4)5/h6,11-12,14-15H,1,7-10H2,2-5H3.
What are the key properties of 3-(hex-5-en-2-ylamino)-4,4-dimethylpentan-1-ol?
3-(hex-5-en-2-ylamino)-4,4-dimethylpentan-1-ol has a molecular weight of 213.36 g/mol, XLogP of 2.73, 7 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(hex-5-en-2-ylamino)-4,4-dimethylpentan-1-ol is sourced from PubChem (CID 104925900), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).