C14H21N5O — CID 10492653
1,4-dipropyl-8,9-dihydro-7H-pyrimido[2,1-f]purin-5-one (PubChem CID 10492653) has the molecular formula C14H21N5O and a molecular weight of 275.36 g/mol. Its IUPAC name is 1,4-dipropyl-8,9-dihydro-7H-pyrimido[2,1-f]purin-5-one.
| Compound Name | 1,4-dipropyl-8,9-dihydro-7H-pyrimido[2,1-f]purin-5-one |
|---|---|
| PubChem CID | 10492653 |
| Molecular Formula | C14H21N5O |
| Molecular Weight | 275.36 g/mol |
| Exact Mass | 275.17 |
| IUPAC Name | 1,4-dipropyl-8,9-dihydro-7H-pyrimido[2,1-f]purin-5-one |
| SMILES | CCCN1C(=O)N2CCCN=C2c2c1ncn2CCC |
| InChI | InChI=1S/C14H21N5O/c1-3-7-17-10-16-13-11(17)12-15-6-5-9-19(12)14(20)18(13)8-4-2/h10H,3-9H2,1-2H3 |
| InChIKey | HQJWFUVSIOTUTJ-UHFFFAOYSA-N |
| XLogP | 2.10 |
| TPSA | 53.73 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.36 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |