C11H23NO3S — CID 104926800
1-(1,1-dioxo-1,4-thiazepan-4-yl)-2,3-dimethylbutan-2-ol (PubChem CID 104926800) has the molecular formula C11H23NO3S and a molecular weight of 249.38 g/mol. Its IUPAC name is 1-(1,1-dioxo-1,4-thiazepan-4-yl)-2,3-dimethylbutan-2-ol.
| Compound Name | 1-(1,1-dioxo-1,4-thiazepan-4-yl)-2,3-dimethylbutan-2-ol |
|---|---|
| PubChem CID | 104926800 |
| Molecular Formula | C11H23NO3S |
| Molecular Weight | 249.38 g/mol |
| Exact Mass | 249.14 |
| IUPAC Name | 1-(1,1-dioxo-1,4-thiazepan-4-yl)-2,3-dimethylbutan-2-ol |
| SMILES | CC(C)C(C)(O)CN1CCCS(=O)(=O)CC1 |
| InChI | InChI=1S/C11H23NO3S/c1-10(2)11(3,13)9-12-5-4-7-16(14,15)8-6-12/h10,13H,4-9H2,1-3H3 |
| InChIKey | GUTDBEALRQFNPI-UHFFFAOYSA-N |
| XLogP | 0.51 |
| TPSA | 57.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.38 |
| LogP ≤ 5 | 0.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |