C13H19N3O2 — CID 104927951
(E)-N-[(1R,2R)-2-hydroxycyclohexyl]-3-(1-methylpyrazol-4-yl)prop-2-enamide (PubChem CID 104927951) has the molecular formula C13H19N3O2 and a molecular weight of 249.31 g/mol. Its IUPAC name is (E)-N-[(1R,2R)-2-hydroxycyclohexyl]-3-(1-methylpyrazol-4-yl)prop-2-enamide.
| Compound Name | (E)-N-[(1R,2R)-2-hydroxycyclohexyl]-3-(1-methylpyrazol-4-yl)prop-2-enamide |
|---|---|
| PubChem CID | 104927951 |
| Molecular Formula | C13H19N3O2 |
| Molecular Weight | 249.31 g/mol |
| Exact Mass | 249.15 |
| IUPAC Name | (E)-N-[(1R,2R)-2-hydroxycyclohexyl]-3-(1-methylpyrazol-4-yl)prop-2-enamide |
| SMILES | Cn1cc(/C=C/C(=O)N[C@@H]2CCCC[C@H]2O)cn1 |
| InChI | InChI=1S/C13H19N3O2/c1-16-9-10(8-14-16)6-7-13(18)15-11-4-2-3-5-12(11)17/h6-9,11-12,17H,2-5H2,1H3,(H,15,18)/b7-6+/t11-,12-/m1/s1 |
| InChIKey | LDOSALDANPHQEI-BYAJROORSA-N |
| XLogP | 0.85 |
| TPSA | 67.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.31 |
| LogP ≤ 5 | 0.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|