C13H16BrNO3 — CID 104927973
5-bromo-2-hydroxy-N-[(1R,2R)-2-hydroxycyclohexyl]benzamide (PubChem CID 104927973) has the molecular formula C13H16BrNO3 and a molecular weight of 314.18 g/mol. Its IUPAC name is 5-bromo-2-hydroxy-N-[(1R,2R)-2-hydroxycyclohexyl]benzamide.
| Compound Name | 5-bromo-2-hydroxy-N-[(1R,2R)-2-hydroxycyclohexyl]benzamide |
|---|---|
| PubChem CID | 104927973 |
| Molecular Formula | C13H16BrNO3 |
| Molecular Weight | 314.18 g/mol |
| Exact Mass | 313.03 |
| IUPAC Name | 5-bromo-2-hydroxy-N-[(1R,2R)-2-hydroxycyclohexyl]benzamide |
| SMILES | O=C(N[C@@H]1CCCC[C@H]1O)c1cc(Br)ccc1O |
| InChI | InChI=1S/C13H16BrNO3/c14-8-5-6-11(16)9(7-8)13(18)15-10-3-1-2-4-12(10)17/h5-7,10,12,16-17H,1-4H2,(H,15,18)/t10-,12-/m1/s1 |
| InChIKey | BPPHCDDEUAXSCH-ZYHUDNBSSA-N |
| XLogP | 2.19 |
| TPSA | 69.56 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.18 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |