C10H16F3N5OS — CID 104928290
N'-hydroxy-3-[2-methylpropyl-[5-(trifluoromethyl)-1,3,4-thiadiazol-2-yl]amino]propanimidamide (PubChem CID 104928290) has the molecular formula C10H16F3N5OS and a molecular weight of 311.33 g/mol. Its IUPAC name is N'-hydroxy-3-[2-methylpropyl-[5-(trifluoromethyl)-1,3,4-thiadiazol-2-yl]amino]propanimidamide.
| Compound Name | N'-hydroxy-3-[2-methylpropyl-[5-(trifluoromethyl)-1,3,4-thiadiazol-2-yl]amino]propanimidamide |
|---|---|
| PubChem CID | 104928290 |
| Molecular Formula | C10H16F3N5OS |
| Molecular Weight | 311.33 g/mol |
| Exact Mass | 311.10 |
| IUPAC Name | N'-hydroxy-3-[2-methylpropyl-[5-(trifluoromethyl)-1,3,4-thiadiazol-2-yl]amino]propanimidamide |
| SMILES | CC(C)CN(CCC(N)=NO)c1nnc(C(F)(F)F)s1 |
| InChI | InChI=1S/C10H16F3N5OS/c1-6(2)5-18(4-3-7(14)17-19)9-16-15-8(20-9)10(11,12)13/h6,19H,3-5H2,1-2H3,(H2,14,17) |
| InChIKey | FUZJRRQBPWOOQQ-UHFFFAOYSA-N |
| XLogP | 2.16 |
| TPSA | 87.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.33 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|