C14H22F3NO4 — CID 104928364
tert-butyl 4-oxo-3-[2-(2,2,2-trifluoroethoxy)ethyl]piperidine-1-carboxylate (PubChem CID 104928364) has the molecular formula C14H22F3NO4 and a molecular weight of 325.33 g/mol. Its IUPAC name is tert-butyl 4-oxo-3-[2-(2,2,2-trifluoroethoxy)ethyl]piperidine-1-carboxylate.
| Compound Name | tert-butyl 4-oxo-3-[2-(2,2,2-trifluoroethoxy)ethyl]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 104928364 |
| Molecular Formula | C14H22F3NO4 |
| Molecular Weight | 325.33 g/mol |
| Exact Mass | 325.15 |
| IUPAC Name | tert-butyl 4-oxo-3-[2-(2,2,2-trifluoroethoxy)ethyl]piperidine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCC(=O)C(CCOCC(F)(F)F)C1 |
| InChI | InChI=1S/C14H22F3NO4/c1-13(2,3)22-12(20)18-6-4-11(19)10(8-18)5-7-21-9-14(15,16)17/h10H,4-9H2,1-3H3 |
| InChIKey | OVZPJRDGXQYKJE-UHFFFAOYSA-N |
| XLogP | 2.78 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.33 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|