About 5-[(5-phenyl-2,3-dihydro-1-benzofuran-2-yl)methyl]-4,5-dihydro-1H-imidazole
5-[(5-phenyl-2,3-dihydro-1-benzofuran-2-yl)methyl]-4,5-dihydro-1H-imidazole (PubChem CID 10492867) has the molecular formula C18H18N2O
and a molecular weight of 278.36 g/mol. Its IUPAC name is 5-[(5-phenyl-2,3-dihydro-1-benzofuran-2-yl)methyl]-4,5-dihydro-1H-imidazole.
Molecular Properties
| Compound Name | 5-[(5-phenyl-2,3-dihydro-1-benzofuran-2-yl)methyl]-4,5-dihydro-1H-imidazole |
| PubChem CID | 10492867 |
| Molecular Formula | C18H18N2O |
| Molecular Weight | 278.36 g/mol |
| Exact Mass | 278.14 |
| IUPAC Name | 5-[(5-phenyl-2,3-dihydro-1-benzofuran-2-yl)methyl]-4,5-dihydro-1H-imidazole |
| SMILES | C1=NCC(CC2Cc3cc(-c4ccccc4)ccc3O2)N1 |
| InChI | InChI=1S/C18H18N2O/c1-2-4-13(5-3-1)14-6-7-18-15(8-14)9-17(21-18)10-16-11-19-12-20-16/h1-8,12,16-17H,9-11H2,(H,19,20) |
| InChIKey | JMWRFJRYQCSQNK-UHFFFAOYSA-N |
| XLogP | 3.05 |
| TPSA | 33.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 278.36 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 5-[(5-phenyl-2,3-dihydro-1-benzofuran-2-yl)methyl]-4,5-dihydro-1H-imidazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-[(5-phenyl-2,3-dihydro-1-benzofuran-2-yl)methyl]-4,5-dihydro-1H-imidazole?
The IUPAC name of 5-[(5-phenyl-2,3-dihydro-1-benzofuran-2-yl)methyl]-4,5-dihydro-1H-imidazole (CID 10492867) is 5-[(5-phenyl-2,3-dihydro-1-benzofuran-2-yl)methyl]-4,5-dihydro-1H-imidazole.
What is the SMILES notation for 5-[(5-phenyl-2,3-dihydro-1-benzofuran-2-yl)methyl]-4,5-dihydro-1H-imidazole?
The canonical SMILES for 5-[(5-phenyl-2,3-dihydro-1-benzofuran-2-yl)methyl]-4,5-dihydro-1H-imidazole is C1=NCC(CC2Cc3cc(-c4ccccc4)ccc3O2)N1.
What is the InChIKey of 5-[(5-phenyl-2,3-dihydro-1-benzofuran-2-yl)methyl]-4,5-dihydro-1H-imidazole?
The InChIKey is JMWRFJRYQCSQNK-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H18N2O/c1-2-4-13(5-3-1)14-6-7-18-15(8-14)9-17(21-18)10-16-11-19-12-20-16/h1-8,12,16-17H,9-11H2,(H,19,20).
What are the key properties of 5-[(5-phenyl-2,3-dihydro-1-benzofuran-2-yl)methyl]-4,5-dihydro-1H-imidazole?
5-[(5-phenyl-2,3-dihydro-1-benzofuran-2-yl)methyl]-4,5-dihydro-1H-imidazole has a molecular weight of 278.36 g/mol, XLogP of 3.05, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 5-[(5-phenyl-2,3-dihydro-1-benzofuran-2-yl)methyl]-4,5-dihydro-1H-imidazole is sourced from PubChem (CID 10492867), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).