About 3-chloroquinolino[4,3-b]quinolin-7-amine
3-chloroquinolino[4,3-b]quinolin-7-amine (PubChem CID 10492974) has the molecular formula C16H10ClN3
and a molecular weight of 279.73 g/mol. Its IUPAC name is 3-chloroquinolino[4,3-b]quinolin-7-amine.
Molecular Properties
| Compound Name | 3-chloroquinolino[4,3-b]quinolin-7-amine |
| PubChem CID | 10492974 |
| Molecular Formula | C16H10ClN3 |
| Molecular Weight | 279.73 g/mol |
| Exact Mass | 279.06 |
| IUPAC Name | 3-chloroquinolino[4,3-b]quinolin-7-amine |
| SMILES | Nc1c2ccccc2nc2c1cnc1cc(Cl)ccc12 |
| InChI | InChI=1S/C16H10ClN3/c17-9-5-6-11-14(7-9)19-8-12-15(18)10-3-1-2-4-13(10)20-16(11)12/h1-8H,(H2,18,20) |
| InChIKey | SPULWVRBHAEJOM-UHFFFAOYSA-N |
| XLogP | 4.17 |
| TPSA | 51.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 279.73 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|
Analyze 3-chloroquinolino[4,3-b]quinolin-7-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-chloroquinolino[4,3-b]quinolin-7-amine?
The IUPAC name of 3-chloroquinolino[4,3-b]quinolin-7-amine (CID 10492974) is 3-chloroquinolino[4,3-b]quinolin-7-amine.
What is the SMILES notation for 3-chloroquinolino[4,3-b]quinolin-7-amine?
The canonical SMILES for 3-chloroquinolino[4,3-b]quinolin-7-amine is Nc1c2ccccc2nc2c1cnc1cc(Cl)ccc12.
What is the InChIKey of 3-chloroquinolino[4,3-b]quinolin-7-amine?
The InChIKey is SPULWVRBHAEJOM-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H10ClN3/c17-9-5-6-11-14(7-9)19-8-12-15(18)10-3-1-2-4-13(10)20-16(11)12/h1-8H,(H2,18,20).
What are the key properties of 3-chloroquinolino[4,3-b]quinolin-7-amine?
3-chloroquinolino[4,3-b]quinolin-7-amine has a molecular weight of 279.73 g/mol, XLogP of 4.17, 0 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-chloroquinolino[4,3-b]quinolin-7-amine is sourced from PubChem (CID 10492974), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).