C10H20N2O3S — CID 104930877
N-(1-tert-butylsulfonyl-3-methylpiperidin-4-ylidene)hydroxylamine (PubChem CID 104930877) has the molecular formula C10H20N2O3S and a molecular weight of 248.35 g/mol. Its IUPAC name is N-(1-tert-butylsulfonyl-3-methylpiperidin-4-ylidene)hydroxylamine.
| Compound Name | N-(1-tert-butylsulfonyl-3-methylpiperidin-4-ylidene)hydroxylamine |
|---|---|
| PubChem CID | 104930877 |
| Molecular Formula | C10H20N2O3S |
| Molecular Weight | 248.35 g/mol |
| Exact Mass | 248.12 |
| IUPAC Name | N-(1-tert-butylsulfonyl-3-methylpiperidin-4-ylidene)hydroxylamine |
| SMILES | CC1CN(S(=O)(=O)C(C)(C)C)CCC1=NO |
| InChI | InChI=1S/C10H20N2O3S/c1-8-7-12(6-5-9(8)11-13)16(14,15)10(2,3)4/h8,13H,5-7H2,1-4H3 |
| InChIKey | MCJJUERAYRLWEA-UHFFFAOYSA-N |
| XLogP | 1.29 |
| TPSA | 69.97 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.35 |
| LogP ≤ 5 | 1.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|