About 3-ethyl-4-hydroxyimino-N,N-dimethylpiperidine-1-sulfonamide
3-ethyl-4-hydroxyimino-N,N-dimethylpiperidine-1-sulfonamide (PubChem CID 104931368) has the molecular formula C9H19N3O3S
and a molecular weight of 249.34 g/mol. Its IUPAC name is 3-ethyl-4-hydroxyimino-N,N-dimethylpiperidine-1-sulfonamide.
Molecular Properties
| Compound Name | 3-ethyl-4-hydroxyimino-N,N-dimethylpiperidine-1-sulfonamide |
| PubChem CID | 104931368 |
| Molecular Formula | C9H19N3O3S |
| Molecular Weight | 249.34 g/mol |
| Exact Mass | 249.11 |
| IUPAC Name | 3-ethyl-4-hydroxyimino-N,N-dimethylpiperidine-1-sulfonamide |
| SMILES | CCC1CN(S(=O)(=O)N(C)C)CCC1=NO |
| InChI | InChI=1S/C9H19N3O3S/c1-4-8-7-12(6-5-9(8)10-13)16(14,15)11(2)3/h8,13H,4-7H2,1-3H3 |
| InChIKey | OCTUZUICOOWQOF-UHFFFAOYSA-N |
| XLogP | 0.35 |
| TPSA | 73.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 249.34 |
| LogP ≤ 5 | 0.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 3-ethyl-4-hydroxyimino-N,N-dimethylpiperidine-1-sulfonamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-ethyl-4-hydroxyimino-N,N-dimethylpiperidine-1-sulfonamide?
The IUPAC name of 3-ethyl-4-hydroxyimino-N,N-dimethylpiperidine-1-sulfonamide (CID 104931368) is 3-ethyl-4-hydroxyimino-N,N-dimethylpiperidine-1-sulfonamide.
What is the SMILES notation for 3-ethyl-4-hydroxyimino-N,N-dimethylpiperidine-1-sulfonamide?
The canonical SMILES for 3-ethyl-4-hydroxyimino-N,N-dimethylpiperidine-1-sulfonamide is CCC1CN(S(=O)(=O)N(C)C)CCC1=NO.
What is the InChIKey of 3-ethyl-4-hydroxyimino-N,N-dimethylpiperidine-1-sulfonamide?
The InChIKey is OCTUZUICOOWQOF-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H19N3O3S/c1-4-8-7-12(6-5-9(8)10-13)16(14,15)11(2)3/h8,13H,4-7H2,1-3H3.
What are the key properties of 3-ethyl-4-hydroxyimino-N,N-dimethylpiperidine-1-sulfonamide?
3-ethyl-4-hydroxyimino-N,N-dimethylpiperidine-1-sulfonamide has a molecular weight of 249.34 g/mol, XLogP of 0.35, 3 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-ethyl-4-hydroxyimino-N,N-dimethylpiperidine-1-sulfonamide is sourced from PubChem (CID 104931368), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).