About N-[3-ethyl-1-(2,2,2-trifluoroethyl)piperidin-4-ylidene]hydroxylamine
N-[3-ethyl-1-(2,2,2-trifluoroethyl)piperidin-4-ylidene]hydroxylamine (PubChem CID 104931407) has the molecular formula C9H15F3N2O
and a molecular weight of 224.23 g/mol. Its IUPAC name is N-[3-ethyl-1-(2,2,2-trifluoroethyl)piperidin-4-ylidene]hydroxylamine.
Molecular Properties
| Compound Name | N-[3-ethyl-1-(2,2,2-trifluoroethyl)piperidin-4-ylidene]hydroxylamine |
| PubChem CID | 104931407 |
| Molecular Formula | C9H15F3N2O |
| Molecular Weight | 224.23 g/mol |
| Exact Mass | 224.11 |
| IUPAC Name | N-[3-ethyl-1-(2,2,2-trifluoroethyl)piperidin-4-ylidene]hydroxylamine |
| SMILES | CCC1CN(CC(F)(F)F)CCC1=NO |
| InChI | InChI=1S/C9H15F3N2O/c1-2-7-5-14(6-9(10,11)12)4-3-8(7)13-15/h7,15H,2-6H2,1H3 |
| InChIKey | RKSQVXHAZOASDJ-UHFFFAOYSA-N |
| XLogP | 2.11 |
| TPSA | 35.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 224.23 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze N-[3-ethyl-1-(2,2,2-trifluoroethyl)piperidin-4-ylidene]hydroxylamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[3-ethyl-1-(2,2,2-trifluoroethyl)piperidin-4-ylidene]hydroxylamine?
The IUPAC name of N-[3-ethyl-1-(2,2,2-trifluoroethyl)piperidin-4-ylidene]hydroxylamine (CID 104931407) is N-[3-ethyl-1-(2,2,2-trifluoroethyl)piperidin-4-ylidene]hydroxylamine.
What is the SMILES notation for N-[3-ethyl-1-(2,2,2-trifluoroethyl)piperidin-4-ylidene]hydroxylamine?
The canonical SMILES for N-[3-ethyl-1-(2,2,2-trifluoroethyl)piperidin-4-ylidene]hydroxylamine is CCC1CN(CC(F)(F)F)CCC1=NO.
What is the InChIKey of N-[3-ethyl-1-(2,2,2-trifluoroethyl)piperidin-4-ylidene]hydroxylamine?
The InChIKey is RKSQVXHAZOASDJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H15F3N2O/c1-2-7-5-14(6-9(10,11)12)4-3-8(7)13-15/h7,15H,2-6H2,1H3.
What are the key properties of N-[3-ethyl-1-(2,2,2-trifluoroethyl)piperidin-4-ylidene]hydroxylamine?
N-[3-ethyl-1-(2,2,2-trifluoroethyl)piperidin-4-ylidene]hydroxylamine has a molecular weight of 224.23 g/mol, XLogP of 2.11, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-[3-ethyl-1-(2,2,2-trifluoroethyl)piperidin-4-ylidene]hydroxylamine is sourced from PubChem (CID 104931407), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).