C14H14N6O — CID 10493146
11-butyl-4-(furan-2-yl)-3,5,6,8,10,11-hexazatricyclo[7.3.0.02,6]dodeca-1(12),2,4,7,9-pentaene (PubChem CID 10493146) has the molecular formula C14H14N6O and a molecular weight of 282.31 g/mol. Its IUPAC name is 11-butyl-4-(furan-2-yl)-3,5,6,8,10,11-hexazatricyclo[7.3.0.02,6]dodeca-1(12),2,4,7,9-pentaene.
| Compound Name | 11-butyl-4-(furan-2-yl)-3,5,6,8,10,11-hexazatricyclo[7.3.0.02,6]dodeca-1(12),2,4,7,9-pentaene |
|---|---|
| PubChem CID | 10493146 |
| Molecular Formula | C14H14N6O |
| Molecular Weight | 282.31 g/mol |
| Exact Mass | 282.12 |
| IUPAC Name | 11-butyl-4-(furan-2-yl)-3,5,6,8,10,11-hexazatricyclo[7.3.0.02,6]dodeca-1(12),2,4,7,9-pentaene |
| SMILES | CCCCn1cc2c(ncn3nc(-c4ccco4)nc23)n1 |
| InChI | InChI=1S/C14H14N6O/c1-2-3-6-19-8-10-12(17-19)15-9-20-14(10)16-13(18-20)11-5-4-7-21-11/h4-5,7-9H,2-3,6H2,1H3 |
| InChIKey | XYSQEJMWZUTVIF-UHFFFAOYSA-N |
| XLogP | 2.53 |
| TPSA | 74.04 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.31 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |