C12H16F3NO3 — CID 104931625
5-ethyl-2-(3,3,3-trifluoro-2-hydroxypropyl)-4,5,6,6a-tetrahydro-3aH-cyclopenta[c]pyrrole-1,3-dione (PubChem CID 104931625) has the molecular formula C12H16F3NO3 and a molecular weight of 279.26 g/mol. Its IUPAC name is 5-ethyl-2-(3,3,3-trifluoro-2-hydroxypropyl)-4,5,6,6a-tetrahydro-3aH-cyclopenta[c]pyrrole-1,3-dione.
| Compound Name | 5-ethyl-2-(3,3,3-trifluoro-2-hydroxypropyl)-4,5,6,6a-tetrahydro-3aH-cyclopenta[c]pyrrole-1,3-dione |
|---|---|
| PubChem CID | 104931625 |
| Molecular Formula | C12H16F3NO3 |
| Molecular Weight | 279.26 g/mol |
| Exact Mass | 279.11 |
| IUPAC Name | 5-ethyl-2-(3,3,3-trifluoro-2-hydroxypropyl)-4,5,6,6a-tetrahydro-3aH-cyclopenta[c]pyrrole-1,3-dione |
| SMILES | CCC1CC2C(=O)N(CC(O)C(F)(F)F)C(=O)C2C1 |
| InChI | InChI=1S/C12H16F3NO3/c1-2-6-3-7-8(4-6)11(19)16(10(7)18)5-9(17)12(13,14)15/h6-9,17H,2-5H2,1H3 |
| InChIKey | OZXWQJRNYHSQDR-UHFFFAOYSA-N |
| XLogP | 1.33 |
| TPSA | 57.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.26 |
| LogP ≤ 5 | 1.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|