C17H16FNO2 — CID 10493368
ethyl (2S,3S)-3-(4-fluorophenyl)-1-phenylaziridine-2-carboxylate (PubChem CID 10493368) has the molecular formula C17H16FNO2 and a molecular weight of 285.32 g/mol. Its IUPAC name is ethyl (2S,3S)-3-(4-fluorophenyl)-1-phenylaziridine-2-carboxylate.
| Compound Name | ethyl (2S,3S)-3-(4-fluorophenyl)-1-phenylaziridine-2-carboxylate |
|---|---|
| PubChem CID | 10493368 |
| Molecular Formula | C17H16FNO2 |
| Molecular Weight | 285.32 g/mol |
| Exact Mass | 285.12 |
| IUPAC Name | ethyl (2S,3S)-3-(4-fluorophenyl)-1-phenylaziridine-2-carboxylate |
| SMILES | CCOC(=O)[C@@H]1[C@H](c2ccc(F)cc2)N1c1ccccc1 |
| InChI | InChI=1S/C17H16FNO2/c1-2-21-17(20)16-15(12-8-10-13(18)11-9-12)19(16)14-6-4-3-5-7-14/h3-11,15-16H,2H2,1H3/t15-,16-,19?/m0/s1 |
| InChIKey | YIGQBDDNUWXNHR-NRAVZPKASA-N |
| XLogP | 3.32 |
| TPSA | 29.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.32 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|