C10H10N2O6S — CID 10493409
3-[4-(hydroxyamino)-1,1,3-trioxo-1,2-benzothiazol-2-yl]propanoic acid (PubChem CID 10493409) has the molecular formula C10H10N2O6S and a molecular weight of 286.26 g/mol. Its IUPAC name is 3-[4-(hydroxyamino)-1,1,3-trioxo-1,2-benzothiazol-2-yl]propanoic acid.
| Compound Name | 3-[4-(hydroxyamino)-1,1,3-trioxo-1,2-benzothiazol-2-yl]propanoic acid |
|---|---|
| PubChem CID | 10493409 |
| Molecular Formula | C10H10N2O6S |
| Molecular Weight | 286.26 g/mol |
| Exact Mass | 286.03 |
| IUPAC Name | 3-[4-(hydroxyamino)-1,1,3-trioxo-1,2-benzothiazol-2-yl]propanoic acid |
| SMILES | O=C(O)CCN1C(=O)c2c(NO)cccc2S1(=O)=O |
| InChI | InChI=1S/C10H10N2O6S/c13-8(14)4-5-12-10(15)9-6(11-16)2-1-3-7(9)19(12,17)18/h1-3,11,16H,4-5H2,(H,13,14) |
| InChIKey | DCGGTTZNRSLCSQ-UHFFFAOYSA-N |
| XLogP | 0.11 |
| TPSA | 124.01 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.26 |
| LogP ≤ 5 | 0.11 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|