C17H18O4 — CID 10493430
[(3S,4S,5E,11E)-4-acetyloxytrideca-1,5,11-trien-7,9-diyn-3-yl] acetate (PubChem CID 10493430) has the molecular formula C17H18O4 and a molecular weight of 286.33 g/mol. Its IUPAC name is [(3S,4S,5E,11E)-4-acetyloxytrideca-1,5,11-trien-7,9-diyn-3-yl] acetate.
| Compound Name | [(3S,4S,5E,11E)-4-acetyloxytrideca-1,5,11-trien-7,9-diyn-3-yl] acetate |
|---|---|
| PubChem CID | 10493430 |
| Molecular Formula | C17H18O4 |
| Molecular Weight | 286.33 g/mol |
| Exact Mass | 286.12 |
| IUPAC Name | [(3S,4S,5E,11E)-4-acetyloxytrideca-1,5,11-trien-7,9-diyn-3-yl] acetate |
| SMILES | C=C[C@H](OC(C)=O)[C@H](/C=C/C#CC#C/C=C/C)OC(C)=O |
| InChI | InChI=1S/C17H18O4/c1-5-7-8-9-10-11-12-13-17(21-15(4)19)16(6-2)20-14(3)18/h5-7,12-13,16-17H,2H2,1,3-4H3/b7-5+,13-12+/t16-,17-/m0/s1 |
| InChIKey | DNTJYQJNHFCXDN-NOHJFXMASA-N |
| XLogP | 2.17 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.33 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|