C11H15NO7S2 — CID 104934935
(2S)-4-hydroxy-2-[(4-methylsulfonylphenyl)sulfonylamino]butanoic acid (PubChem CID 104934935) has the molecular formula C11H15NO7S2 and a molecular weight of 337.38 g/mol. Its IUPAC name is (2S)-4-hydroxy-2-[(4-methylsulfonylphenyl)sulfonylamino]butanoic acid.
| Compound Name | (2S)-4-hydroxy-2-[(4-methylsulfonylphenyl)sulfonylamino]butanoic acid |
|---|---|
| PubChem CID | 104934935 |
| Molecular Formula | C11H15NO7S2 |
| Molecular Weight | 337.38 g/mol |
| Exact Mass | 337.03 |
| IUPAC Name | (2S)-4-hydroxy-2-[(4-methylsulfonylphenyl)sulfonylamino]butanoic acid |
| SMILES | CS(=O)(=O)c1ccc(S(=O)(=O)N[C@@H](CCO)C(=O)O)cc1 |
| InChI | InChI=1S/C11H15NO7S2/c1-20(16,17)8-2-4-9(5-3-8)21(18,19)12-10(6-7-13)11(14)15/h2-5,10,12-13H,6-7H2,1H3,(H,14,15)/t10-/m0/s1 |
| InChIKey | TXUDOLOGSOMZQW-JTQLQIEISA-N |
| XLogP | -0.80 |
| TPSA | 137.84 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.38 |
| LogP ≤ 5 | -0.80 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |