C17H21NO3 — CID 10493524
2-[(2E)-4,4-dimethyl-2-[2-(4-methylphenyl)-2-oxoethylidene]pyrrolidin-1-yl]acetic acid (PubChem CID 10493524) has the molecular formula C17H21NO3 and a molecular weight of 287.36 g/mol. Its IUPAC name is 2-[(2E)-4,4-dimethyl-2-[2-(4-methylphenyl)-2-oxoethylidene]pyrrolidin-1-yl]acetic acid.
| Compound Name | 2-[(2E)-4,4-dimethyl-2-[2-(4-methylphenyl)-2-oxoethylidene]pyrrolidin-1-yl]acetic acid |
|---|---|
| PubChem CID | 10493524 |
| Molecular Formula | C17H21NO3 |
| Molecular Weight | 287.36 g/mol |
| Exact Mass | 287.15 |
| IUPAC Name | 2-[(2E)-4,4-dimethyl-2-[2-(4-methylphenyl)-2-oxoethylidene]pyrrolidin-1-yl]acetic acid |
| SMILES | Cc1ccc(C(=O)/C=C2\CC(C)(C)CN2CC(=O)O)cc1 |
| InChI | InChI=1S/C17H21NO3/c1-12-4-6-13(7-5-12)15(19)8-14-9-17(2,3)11-18(14)10-16(20)21/h4-8H,9-11H2,1-3H3,(H,20,21)/b14-8+ |
| InChIKey | LPGQJCYTQRASJK-RIYZIHGNSA-N |
| XLogP | 2.88 |
| TPSA | 57.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.36 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|