C12H15BrFNO4S — CID 104936328
3-[(4-bromo-3-fluorophenyl)sulfonylamino]-4-methylpentanoic acid (PubChem CID 104936328) has the molecular formula C12H15BrFNO4S and a molecular weight of 368.22 g/mol. Its IUPAC name is 3-[(4-bromo-3-fluorophenyl)sulfonylamino]-4-methylpentanoic acid.
| Compound Name | 3-[(4-bromo-3-fluorophenyl)sulfonylamino]-4-methylpentanoic acid |
|---|---|
| PubChem CID | 104936328 |
| Molecular Formula | C12H15BrFNO4S |
| Molecular Weight | 368.22 g/mol |
| Exact Mass | 366.99 |
| IUPAC Name | 3-[(4-bromo-3-fluorophenyl)sulfonylamino]-4-methylpentanoic acid |
| SMILES | CC(C)C(CC(=O)O)NS(=O)(=O)c1ccc(Br)c(F)c1 |
| InChI | InChI=1S/C12H15BrFNO4S/c1-7(2)11(6-12(16)17)15-20(18,19)8-3-4-9(13)10(14)5-8/h3-5,7,11,15H,6H2,1-2H3,(H,16,17) |
| InChIKey | JWCIWAKRQPFSNK-UHFFFAOYSA-N |
| XLogP | 2.37 |
| TPSA | 83.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.22 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |