C11H16N2O2 — CID 104936654
2-hydroxy-N,2-dimethyl-N-(pyridin-2-ylmethyl)propanamide (PubChem CID 104936654) has the molecular formula C11H16N2O2 and a molecular weight of 208.26 g/mol. Its IUPAC name is 2-hydroxy-N,2-dimethyl-N-(pyridin-2-ylmethyl)propanamide.
| Compound Name | 2-hydroxy-N,2-dimethyl-N-(pyridin-2-ylmethyl)propanamide |
|---|---|
| PubChem CID | 104936654 |
| Molecular Formula | C11H16N2O2 |
| Molecular Weight | 208.26 g/mol |
| Exact Mass | 208.12 |
| IUPAC Name | 2-hydroxy-N,2-dimethyl-N-(pyridin-2-ylmethyl)propanamide |
| SMILES | CN(Cc1ccccn1)C(=O)C(C)(C)O |
| InChI | InChI=1S/C11H16N2O2/c1-11(2,15)10(14)13(3)8-9-6-4-5-7-12-9/h4-7,15H,8H2,1-3H3 |
| InChIKey | BCGQKKPDKAGJIV-UHFFFAOYSA-N |
| XLogP | 0.81 |
| TPSA | 53.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 208.26 |
| LogP ≤ 5 | 0.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |