C17H23NO3 — CID 10493667
[(3R)-3-(2-hydroxypropyl)-1-oxa-4-azaspiro[4.4]nonan-4-yl]-phenylmethanone (PubChem CID 10493667) has the molecular formula C17H23NO3 and a molecular weight of 289.37 g/mol. Its IUPAC name is [(3R)-3-(2-hydroxypropyl)-1-oxa-4-azaspiro[4.4]nonan-4-yl]-phenylmethanone.
| Compound Name | [(3R)-3-(2-hydroxypropyl)-1-oxa-4-azaspiro[4.4]nonan-4-yl]-phenylmethanone |
|---|---|
| PubChem CID | 10493667 |
| Molecular Formula | C17H23NO3 |
| Molecular Weight | 289.37 g/mol |
| Exact Mass | 289.17 |
| IUPAC Name | [(3R)-3-(2-hydroxypropyl)-1-oxa-4-azaspiro[4.4]nonan-4-yl]-phenylmethanone |
| SMILES | CC(O)C[C@@H]1COC2(CCCC2)N1C(=O)c1ccccc1 |
| InChI | InChI=1S/C17H23NO3/c1-13(19)11-15-12-21-17(9-5-6-10-17)18(15)16(20)14-7-3-2-4-8-14/h2-4,7-8,13,15,19H,5-6,9-12H2,1H3/t13?,15-/m1/s1 |
| InChIKey | LCAVSKGDUBYOAK-AWKYBWMHSA-N |
| XLogP | 2.57 |
| TPSA | 49.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.37 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |