C11H15IO — CID 10493683
4-[(1S,4R)-3-iodo-2-bicyclo[2.2.1]hepta-2,5-dienyl]butan-1-ol (PubChem CID 10493683) has the molecular formula C11H15IO and a molecular weight of 290.14 g/mol. Its IUPAC name is 4-[(1S,4R)-3-iodo-2-bicyclo[2.2.1]hepta-2,5-dienyl]butan-1-ol.
| Compound Name | 4-[(1S,4R)-3-iodo-2-bicyclo[2.2.1]hepta-2,5-dienyl]butan-1-ol |
|---|---|
| PubChem CID | 10493683 |
| Molecular Formula | C11H15IO |
| Molecular Weight | 290.14 g/mol |
| Exact Mass | 290.02 |
| IUPAC Name | 4-[(1S,4R)-3-iodo-2-bicyclo[2.2.1]hepta-2,5-dienyl]butan-1-ol |
| SMILES | OCCCCC1=C(I)[C@H]2C=C[C@@H]1C2 |
| InChI | InChI=1S/C11H15IO/c12-11-9-5-4-8(7-9)10(11)3-1-2-6-13/h4-5,8-9,13H,1-3,6-7H2/t8-,9+/m1/s1 |
| InChIKey | NXRPKVKQYOLPOZ-BDAKNGLRSA-N |
| XLogP | 3.04 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.14 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|