About 4-[(1S,4R)-3-iodo-2-bicyclo[2.2.1]hepta-2,5-dienyl]butan-1-ol
4-[(1S,4R)-3-iodo-2-bicyclo[2.2.1]hepta-2,5-dienyl]butan-1-ol (PubChem CID 10493683) has the molecular formula C11H15IO
and a molecular weight of 290.14 g/mol. Its IUPAC name is 4-[(1S,4R)-3-iodo-2-bicyclo[2.2.1]hepta-2,5-dienyl]butan-1-ol.
Molecular Properties
| Compound Name | 4-[(1S,4R)-3-iodo-2-bicyclo[2.2.1]hepta-2,5-dienyl]butan-1-ol |
| PubChem CID | 10493683 |
| Molecular Formula | C11H15IO |
| Molecular Weight | 290.14 g/mol |
| Exact Mass | 290.02 |
| IUPAC Name | 4-[(1S,4R)-3-iodo-2-bicyclo[2.2.1]hepta-2,5-dienyl]butan-1-ol |
| SMILES | OCCCCC1=C(I)[C@H]2C=C[C@@H]1C2 |
| InChI | InChI=1S/C11H15IO/c12-11-9-5-4-8(7-9)10(11)3-1-2-6-13/h4-5,8-9,13H,1-3,6-7H2/t8-,9+/m1/s1 |
| InChIKey | NXRPKVKQYOLPOZ-BDAKNGLRSA-N |
| XLogP | 3.04 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 290.14 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 4-[(1S,4R)-3-iodo-2-bicyclo[2.2.1]hepta-2,5-dienyl]butan-1-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[(1S,4R)-3-iodo-2-bicyclo[2.2.1]hepta-2,5-dienyl]butan-1-ol?
The IUPAC name of 4-[(1S,4R)-3-iodo-2-bicyclo[2.2.1]hepta-2,5-dienyl]butan-1-ol (CID 10493683) is 4-[(1S,4R)-3-iodo-2-bicyclo[2.2.1]hepta-2,5-dienyl]butan-1-ol.
What is the SMILES notation for 4-[(1S,4R)-3-iodo-2-bicyclo[2.2.1]hepta-2,5-dienyl]butan-1-ol?
The canonical SMILES for 4-[(1S,4R)-3-iodo-2-bicyclo[2.2.1]hepta-2,5-dienyl]butan-1-ol is OCCCCC1=C(I)[C@H]2C=C[C@@H]1C2.
What is the InChIKey of 4-[(1S,4R)-3-iodo-2-bicyclo[2.2.1]hepta-2,5-dienyl]butan-1-ol?
The InChIKey is NXRPKVKQYOLPOZ-BDAKNGLRSA-N. The full InChI is InChI=1S/C11H15IO/c12-11-9-5-4-8(7-9)10(11)3-1-2-6-13/h4-5,8-9,13H,1-3,6-7H2/t8-,9+/m1/s1.
What are the key properties of 4-[(1S,4R)-3-iodo-2-bicyclo[2.2.1]hepta-2,5-dienyl]butan-1-ol?
4-[(1S,4R)-3-iodo-2-bicyclo[2.2.1]hepta-2,5-dienyl]butan-1-ol has a molecular weight of 290.14 g/mol, XLogP of 3.04, 4 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[(1S,4R)-3-iodo-2-bicyclo[2.2.1]hepta-2,5-dienyl]butan-1-ol is sourced from PubChem (CID 10493683), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).