C10H11ClN2O7S — CID 104936862
3-[(2-chloro-4-nitrophenyl)sulfonylamino]-2-methoxypropanoic acid (PubChem CID 104936862) has the molecular formula C10H11ClN2O7S and a molecular weight of 338.73 g/mol. Its IUPAC name is 3-[(2-chloro-4-nitrophenyl)sulfonylamino]-2-methoxypropanoic acid.
| Compound Name | 3-[(2-chloro-4-nitrophenyl)sulfonylamino]-2-methoxypropanoic acid |
|---|---|
| PubChem CID | 104936862 |
| Molecular Formula | C10H11ClN2O7S |
| Molecular Weight | 338.73 g/mol |
| Exact Mass | 338.00 |
| IUPAC Name | 3-[(2-chloro-4-nitrophenyl)sulfonylamino]-2-methoxypropanoic acid |
| SMILES | COC(CNS(=O)(=O)c1ccc([N+](=O)[O-])cc1Cl)C(=O)O |
| InChI | InChI=1S/C10H11ClN2O7S/c1-20-8(10(14)15)5-12-21(18,19)9-3-2-6(13(16)17)4-7(9)11/h2-4,8,12H,5H2,1H3,(H,14,15) |
| InChIKey | QZABRHRDOGPRMD-UHFFFAOYSA-N |
| XLogP | 0.63 |
| TPSA | 135.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.73 |
| LogP ≤ 5 | 0.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|