C12H10F4N2O2 — CID 10493689
3-[4-(2,2,3,3-tetrafluoropropoxy)phenyl]-1H-imidazol-2-one (PubChem CID 10493689) has the molecular formula C12H10F4N2O2 and a molecular weight of 290.22 g/mol. Its IUPAC name is 3-[4-(2,2,3,3-tetrafluoropropoxy)phenyl]-1H-imidazol-2-one.
| Compound Name | 3-[4-(2,2,3,3-tetrafluoropropoxy)phenyl]-1H-imidazol-2-one |
|---|---|
| PubChem CID | 10493689 |
| Molecular Formula | C12H10F4N2O2 |
| Molecular Weight | 290.22 g/mol |
| Exact Mass | 290.07 |
| IUPAC Name | 3-[4-(2,2,3,3-tetrafluoropropoxy)phenyl]-1H-imidazol-2-one |
| SMILES | O=c1[nH]ccn1-c1ccc(OCC(F)(F)C(F)F)cc1 |
| InChI | InChI=1S/C12H10F4N2O2/c13-10(14)12(15,16)7-20-9-3-1-8(2-4-9)18-6-5-17-11(18)19/h1-6,10H,7H2,(H,17,19) |
| InChIKey | AZYAZXCZGOUZPT-UHFFFAOYSA-N |
| XLogP | 2.44 |
| TPSA | 47.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.22 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|