C14H20ClFN2O2 — CID 104938096
tert-butyl N-[2-[(3-chloro-5-fluorophenyl)methylamino]ethyl]carbamate (PubChem CID 104938096) has the molecular formula C14H20ClFN2O2 and a molecular weight of 302.78 g/mol. Its IUPAC name is tert-butyl N-[2-[(3-chloro-5-fluorophenyl)methylamino]ethyl]carbamate.
| Compound Name | tert-butyl N-[2-[(3-chloro-5-fluorophenyl)methylamino]ethyl]carbamate |
|---|---|
| PubChem CID | 104938096 |
| Molecular Formula | C14H20ClFN2O2 |
| Molecular Weight | 302.78 g/mol |
| Exact Mass | 302.12 |
| IUPAC Name | tert-butyl N-[2-[(3-chloro-5-fluorophenyl)methylamino]ethyl]carbamate |
| SMILES | CC(C)(C)OC(=O)NCCNCc1cc(F)cc(Cl)c1 |
| InChI | InChI=1S/C14H20ClFN2O2/c1-14(2,3)20-13(19)18-5-4-17-9-10-6-11(15)8-12(16)7-10/h6-8,17H,4-5,9H2,1-3H3,(H,18,19) |
| InChIKey | GJAXKOWMUXIKSQ-UHFFFAOYSA-N |
| XLogP | 3.09 |
| TPSA | 50.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.78 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|