About 2-bromo-5-[3-[2-(diethylamino)ethyl]-1,2,4-oxadiazol-5-yl]phenol
2-bromo-5-[3-[2-(diethylamino)ethyl]-1,2,4-oxadiazol-5-yl]phenol (PubChem CID 104938437) has the molecular formula C14H18BrN3O2
and a molecular weight of 340.22 g/mol. Its IUPAC name is 2-bromo-5-[3-[2-(diethylamino)ethyl]-1,2,4-oxadiazol-5-yl]phenol.
Molecular Properties
| Compound Name | 2-bromo-5-[3-[2-(diethylamino)ethyl]-1,2,4-oxadiazol-5-yl]phenol |
| PubChem CID | 104938437 |
| Molecular Formula | C14H18BrN3O2 |
| Molecular Weight | 340.22 g/mol |
| Exact Mass | 339.06 |
| IUPAC Name | 2-bromo-5-[3-[2-(diethylamino)ethyl]-1,2,4-oxadiazol-5-yl]phenol |
| SMILES | CCN(CC)CCc1noc(-c2ccc(Br)c(O)c2)n1 |
| InChI | InChI=1S/C14H18BrN3O2/c1-3-18(4-2)8-7-13-16-14(20-17-13)10-5-6-11(15)12(19)9-10/h5-6,9,19H,3-4,7-8H2,1-2H3 |
| InChIKey | GEVOLKZOKWVNIT-UHFFFAOYSA-N |
| XLogP | 3.09 |
| TPSA | 62.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 340.22 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 2-bromo-5-[3-[2-(diethylamino)ethyl]-1,2,4-oxadiazol-5-yl]phenol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-bromo-5-[3-[2-(diethylamino)ethyl]-1,2,4-oxadiazol-5-yl]phenol?
The IUPAC name of 2-bromo-5-[3-[2-(diethylamino)ethyl]-1,2,4-oxadiazol-5-yl]phenol (CID 104938437) is 2-bromo-5-[3-[2-(diethylamino)ethyl]-1,2,4-oxadiazol-5-yl]phenol.
What is the SMILES notation for 2-bromo-5-[3-[2-(diethylamino)ethyl]-1,2,4-oxadiazol-5-yl]phenol?
The canonical SMILES for 2-bromo-5-[3-[2-(diethylamino)ethyl]-1,2,4-oxadiazol-5-yl]phenol is CCN(CC)CCc1noc(-c2ccc(Br)c(O)c2)n1.
What is the InChIKey of 2-bromo-5-[3-[2-(diethylamino)ethyl]-1,2,4-oxadiazol-5-yl]phenol?
The InChIKey is GEVOLKZOKWVNIT-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H18BrN3O2/c1-3-18(4-2)8-7-13-16-14(20-17-13)10-5-6-11(15)12(19)9-10/h5-6,9,19H,3-4,7-8H2,1-2H3.
What are the key properties of 2-bromo-5-[3-[2-(diethylamino)ethyl]-1,2,4-oxadiazol-5-yl]phenol?
2-bromo-5-[3-[2-(diethylamino)ethyl]-1,2,4-oxadiazol-5-yl]phenol has a molecular weight of 340.22 g/mol, XLogP of 3.09, 6 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-bromo-5-[3-[2-(diethylamino)ethyl]-1,2,4-oxadiazol-5-yl]phenol is sourced from PubChem (CID 104938437), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).