C9H11BrN2O — CID 104938547
1-(3-bromo-5-methylphenyl)-3-methylurea (PubChem CID 104938547) has the molecular formula C9H11BrN2O and a molecular weight of 243.10 g/mol. Its IUPAC name is 1-(3-bromo-5-methylphenyl)-3-methylurea.
| Compound Name | 1-(3-bromo-5-methylphenyl)-3-methylurea |
|---|---|
| PubChem CID | 104938547 |
| Molecular Formula | C9H11BrN2O |
| Molecular Weight | 243.10 g/mol |
| Exact Mass | 242.01 |
| IUPAC Name | 1-(3-bromo-5-methylphenyl)-3-methylurea |
| SMILES | CNC(=O)Nc1cc(C)cc(Br)c1 |
| InChI | InChI=1S/C9H11BrN2O/c1-6-3-7(10)5-8(4-6)12-9(13)11-2/h3-5H,1-2H3,(H2,11,12,13) |
| InChIKey | WEHFTKXXEFOXKA-UHFFFAOYSA-N |
| XLogP | 2.51 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 243.10 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |