C13H15BrN2O2 — CID 104938577
N-(3-bromo-5-methylphenyl)-6-oxopiperidine-3-carboxamide (PubChem CID 104938577) has the molecular formula C13H15BrN2O2 and a molecular weight of 311.18 g/mol. Its IUPAC name is N-(3-bromo-5-methylphenyl)-6-oxopiperidine-3-carboxamide.
| Compound Name | N-(3-bromo-5-methylphenyl)-6-oxopiperidine-3-carboxamide |
|---|---|
| PubChem CID | 104938577 |
| Molecular Formula | C13H15BrN2O2 |
| Molecular Weight | 311.18 g/mol |
| Exact Mass | 310.03 |
| IUPAC Name | N-(3-bromo-5-methylphenyl)-6-oxopiperidine-3-carboxamide |
| SMILES | Cc1cc(Br)cc(NC(=O)C2CCC(=O)NC2)c1 |
| InChI | InChI=1S/C13H15BrN2O2/c1-8-4-10(14)6-11(5-8)16-13(18)9-2-3-12(17)15-7-9/h4-6,9H,2-3,7H2,1H3,(H,15,17)(H,16,18) |
| InChIKey | UGBVYEYAKHKXRL-UHFFFAOYSA-N |
| XLogP | 2.22 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.18 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |