C14H21NO3 — CID 104938816
N-(3,3-dimethylbutan-2-yl)-3,5-dihydroxy-N-methylbenzamide (PubChem CID 104938816) has the molecular formula C14H21NO3 and a molecular weight of 251.33 g/mol. Its IUPAC name is N-(3,3-dimethylbutan-2-yl)-3,5-dihydroxy-N-methylbenzamide.
| Compound Name | N-(3,3-dimethylbutan-2-yl)-3,5-dihydroxy-N-methylbenzamide |
|---|---|
| PubChem CID | 104938816 |
| Molecular Formula | C14H21NO3 |
| Molecular Weight | 251.33 g/mol |
| Exact Mass | 251.15 |
| IUPAC Name | N-(3,3-dimethylbutan-2-yl)-3,5-dihydroxy-N-methylbenzamide |
| SMILES | CC(N(C)C(=O)c1cc(O)cc(O)c1)C(C)(C)C |
| InChI | InChI=1S/C14H21NO3/c1-9(14(2,3)4)15(5)13(18)10-6-11(16)8-12(17)7-10/h6-9,16-17H,1-5H3 |
| InChIKey | GMWKCEISGMCKPX-UHFFFAOYSA-N |
| XLogP | 2.60 |
| TPSA | 60.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.33 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |