C13H24N2O — CID 104939658
[(2S)-pyrrolidin-2-yl]-(2,3,5-trimethylpiperidin-1-yl)methanone (PubChem CID 104939658) has the molecular formula C13H24N2O and a molecular weight of 224.35 g/mol. Its IUPAC name is [(2S)-pyrrolidin-2-yl]-(2,3,5-trimethylpiperidin-1-yl)methanone.
| Compound Name | [(2S)-pyrrolidin-2-yl]-(2,3,5-trimethylpiperidin-1-yl)methanone |
|---|---|
| PubChem CID | 104939658 |
| Molecular Formula | C13H24N2O |
| Molecular Weight | 224.35 g/mol |
| Exact Mass | 224.19 |
| IUPAC Name | [(2S)-pyrrolidin-2-yl]-(2,3,5-trimethylpiperidin-1-yl)methanone |
| SMILES | CC1CC(C)C(C)N(C(=O)[C@@H]2CCCN2)C1 |
| InChI | InChI=1S/C13H24N2O/c1-9-7-10(2)11(3)15(8-9)13(16)12-5-4-6-14-12/h9-12,14H,4-8H2,1-3H3/t9?,10?,11?,12-/m0/s1 |
| InChIKey | GXQJXULRKQSUMG-ROAFRPBMSA-N |
| XLogP | 1.63 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 224.35 |
| LogP ≤ 5 | 1.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |