C16H25FN2 — CID 104939708
(1R)-1-[5-fluoro-2-(2,3,5-trimethylpiperidin-1-yl)phenyl]ethanamine (PubChem CID 104939708) has the molecular formula C16H25FN2 and a molecular weight of 264.39 g/mol. Its IUPAC name is (1R)-1-[5-fluoro-2-(2,3,5-trimethylpiperidin-1-yl)phenyl]ethanamine.
| Compound Name | (1R)-1-[5-fluoro-2-(2,3,5-trimethylpiperidin-1-yl)phenyl]ethanamine |
|---|---|
| PubChem CID | 104939708 |
| Molecular Formula | C16H25FN2 |
| Molecular Weight | 264.39 g/mol |
| Exact Mass | 264.20 |
| IUPAC Name | (1R)-1-[5-fluoro-2-(2,3,5-trimethylpiperidin-1-yl)phenyl]ethanamine |
| SMILES | CC1CC(C)C(C)N(c2ccc(F)cc2[C@@H](C)N)C1 |
| InChI | InChI=1S/C16H25FN2/c1-10-7-11(2)13(4)19(9-10)16-6-5-14(17)8-15(16)12(3)18/h5-6,8,10-13H,7,9,18H2,1-4H3/t10?,11?,12-,13?/m1/s1 |
| InChIKey | GUFZEPWZDVFDEW-AYNROABZSA-N |
| XLogP | 3.72 |
| TPSA | 29.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.39 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |