C14H29N3O2 — CID 104940278
3-[ethyl-(2,2,5,5-tetramethyloxolan-3-yl)amino]-N'-hydroxy-2-methylpropanimidamide (PubChem CID 104940278) has the molecular formula C14H29N3O2 and a molecular weight of 271.40 g/mol. Its IUPAC name is 3-[ethyl-(2,2,5,5-tetramethyloxolan-3-yl)amino]-N'-hydroxy-2-methylpropanimidamide.
| Compound Name | 3-[ethyl-(2,2,5,5-tetramethyloxolan-3-yl)amino]-N'-hydroxy-2-methylpropanimidamide |
|---|---|
| PubChem CID | 104940278 |
| Molecular Formula | C14H29N3O2 |
| Molecular Weight | 271.40 g/mol |
| Exact Mass | 271.23 |
| IUPAC Name | 3-[ethyl-(2,2,5,5-tetramethyloxolan-3-yl)amino]-N'-hydroxy-2-methylpropanimidamide |
| SMILES | CCN(CC(C)C(N)=NO)C1CC(C)(C)OC1(C)C |
| InChI | InChI=1S/C14H29N3O2/c1-7-17(9-10(2)12(15)16-18)11-8-13(3,4)19-14(11,5)6/h10-11,18H,7-9H2,1-6H3,(H2,15,16) |
| InChIKey | XQBOMCDLECYYHT-UHFFFAOYSA-N |
| XLogP | 2.04 |
| TPSA | 71.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.40 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|