C17H26O4 — CID 10494033
ethyl (1S,2R,5S,6S)-11-oxo-5-propyl-12-oxatricyclo[4.4.1.12,5]dodecane-1-carboxylate (PubChem CID 10494033) has the molecular formula C17H26O4 and a molecular weight of 294.39 g/mol. Its IUPAC name is ethyl (1S,2R,5S,6S)-11-oxo-5-propyl-12-oxatricyclo[4.4.1.12,5]dodecane-1-carboxylate.
| Compound Name | ethyl (1S,2R,5S,6S)-11-oxo-5-propyl-12-oxatricyclo[4.4.1.12,5]dodecane-1-carboxylate |
|---|---|
| PubChem CID | 10494033 |
| Molecular Formula | C17H26O4 |
| Molecular Weight | 294.39 g/mol |
| Exact Mass | 294.18 |
| IUPAC Name | ethyl (1S,2R,5S,6S)-11-oxo-5-propyl-12-oxatricyclo[4.4.1.12,5]dodecane-1-carboxylate |
| SMILES | CCC[C@@]12CC[C@@H](O1)[C@@]1(C(=O)OCC)CCCC[C@@H]2C1=O |
| InChI | InChI=1S/C17H26O4/c1-3-9-16-11-8-13(21-16)17(15(19)20-4-2)10-6-5-7-12(16)14(17)18/h12-13H,3-11H2,1-2H3/t12-,13-,16+,17+/m1/s1 |
| InChIKey | CTGZEBKHCKNHFK-OMNBBPDLSA-N |
| XLogP | 3.03 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.39 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|