C13H25NO — CID 104940356
4-(2,2,5,5-tetramethyloxolan-3-yl)pent-3-en-1-amine (PubChem CID 104940356) has the molecular formula C13H25NO and a molecular weight of 211.35 g/mol. Its IUPAC name is 4-(2,2,5,5-tetramethyloxolan-3-yl)pent-3-en-1-amine.
| Compound Name | 4-(2,2,5,5-tetramethyloxolan-3-yl)pent-3-en-1-amine |
|---|---|
| PubChem CID | 104940356 |
| Molecular Formula | C13H25NO |
| Molecular Weight | 211.35 g/mol |
| Exact Mass | 211.19 |
| IUPAC Name | 4-(2,2,5,5-tetramethyloxolan-3-yl)pent-3-en-1-amine |
| SMILES | CC(=CCCN)C1CC(C)(C)OC1(C)C |
| InChI | InChI=1S/C13H25NO/c1-10(7-6-8-14)11-9-12(2,3)15-13(11,4)5/h7,11H,6,8-9,14H2,1-5H3 |
| InChIKey | PRKUBWNTMSDRIB-UHFFFAOYSA-N |
| XLogP | 2.88 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 211.35 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|