C11H18BrN3O — CID 104940626
4-[4-bromo-1-(2-methoxyethyl)pyrazol-5-yl]pent-3-en-1-amine (PubChem CID 104940626) has the molecular formula C11H18BrN3O and a molecular weight of 288.19 g/mol. Its IUPAC name is 4-[4-bromo-1-(2-methoxyethyl)pyrazol-5-yl]pent-3-en-1-amine.
| Compound Name | 4-[4-bromo-1-(2-methoxyethyl)pyrazol-5-yl]pent-3-en-1-amine |
|---|---|
| PubChem CID | 104940626 |
| Molecular Formula | C11H18BrN3O |
| Molecular Weight | 288.19 g/mol |
| Exact Mass | 287.06 |
| IUPAC Name | 4-[4-bromo-1-(2-methoxyethyl)pyrazol-5-yl]pent-3-en-1-amine |
| SMILES | COCCn1ncc(Br)c1C(C)=CCCN |
| InChI | InChI=1S/C11H18BrN3O/c1-9(4-3-5-13)11-10(12)8-14-15(11)6-7-16-2/h4,8H,3,5-7,13H2,1-2H3 |
| InChIKey | JURZOSZMNBXWJT-UHFFFAOYSA-N |
| XLogP | 2.04 |
| TPSA | 53.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.19 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |