C19H21NO2 — CID 10494099
10,10-dimethyl-4-propyl-5,11-dioxa-3-azatetracyclo[11.4.0.02,6.07,12]heptadeca-1(17),2(6),3,7(12),13,15-hexaene (PubChem CID 10494099) has the molecular formula C19H21NO2 and a molecular weight of 295.38 g/mol. Its IUPAC name is 10,10-dimethyl-4-propyl-5,11-dioxa-3-azatetracyclo[11.4.0.02,6.07,12]heptadeca-1(17),2(6),3,7(12),13,15-hexaene.
| Compound Name | 10,10-dimethyl-4-propyl-5,11-dioxa-3-azatetracyclo[11.4.0.02,6.07,12]heptadeca-1(17),2(6),3,7(12),13,15-hexaene |
|---|---|
| PubChem CID | 10494099 |
| Molecular Formula | C19H21NO2 |
| Molecular Weight | 295.38 g/mol |
| Exact Mass | 295.16 |
| IUPAC Name | 10,10-dimethyl-4-propyl-5,11-dioxa-3-azatetracyclo[11.4.0.02,6.07,12]heptadeca-1(17),2(6),3,7(12),13,15-hexaene |
| SMILES | CCCc1nc2c(o1)c1c(c3ccccc32)OC(C)(C)CC1 |
| InChI | InChI=1S/C19H21NO2/c1-4-7-15-20-16-12-8-5-6-9-13(12)17-14(18(16)21-15)10-11-19(2,3)22-17/h5-6,8-9H,4,7,10-11H2,1-3H3 |
| InChIKey | PNJRBKPLSVUHIG-UHFFFAOYSA-N |
| XLogP | 5.04 |
| TPSA | 35.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.38 |
| LogP ≤ 5 | 5.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |