About (3S)-1,1,1-trifluoro-5-methoxy-4-methylpentan-3-amine
(3S)-1,1,1-trifluoro-5-methoxy-4-methylpentan-3-amine (PubChem CID 104941335) has the molecular formula C7H14F3NO
and a molecular weight of 185.19 g/mol. Its IUPAC name is (3S)-1,1,1-trifluoro-5-methoxy-4-methylpentan-3-amine.
Molecular Properties
| Compound Name | (3S)-1,1,1-trifluoro-5-methoxy-4-methylpentan-3-amine |
| PubChem CID | 104941335 |
| Molecular Formula | C7H14F3NO |
| Molecular Weight | 185.19 g/mol |
| Exact Mass | 185.10 |
| IUPAC Name | (3S)-1,1,1-trifluoro-5-methoxy-4-methylpentan-3-amine |
| SMILES | COCC(C)[C@@H](N)CC(F)(F)F |
| InChI | InChI=1S/C7H14F3NO/c1-5(4-12-2)6(11)3-7(8,9)10/h5-6H,3-4,11H2,1-2H3/t5?,6-/m0/s1 |
| InChIKey | APUQKFDQIRYUHI-GDVGLLTNSA-N |
| XLogP | 1.55 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 185.19 |
| LogP ≤ 5 | 1.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze (3S)-1,1,1-trifluoro-5-methoxy-4-methylpentan-3-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3S)-1,1,1-trifluoro-5-methoxy-4-methylpentan-3-amine?
The IUPAC name of (3S)-1,1,1-trifluoro-5-methoxy-4-methylpentan-3-amine (CID 104941335) is (3S)-1,1,1-trifluoro-5-methoxy-4-methylpentan-3-amine.
What is the SMILES notation for (3S)-1,1,1-trifluoro-5-methoxy-4-methylpentan-3-amine?
The canonical SMILES for (3S)-1,1,1-trifluoro-5-methoxy-4-methylpentan-3-amine is COCC(C)[C@@H](N)CC(F)(F)F.
What is the InChIKey of (3S)-1,1,1-trifluoro-5-methoxy-4-methylpentan-3-amine?
The InChIKey is APUQKFDQIRYUHI-GDVGLLTNSA-N. The full InChI is InChI=1S/C7H14F3NO/c1-5(4-12-2)6(11)3-7(8,9)10/h5-6H,3-4,11H2,1-2H3/t5?,6-/m0/s1.
What are the key properties of (3S)-1,1,1-trifluoro-5-methoxy-4-methylpentan-3-amine?
(3S)-1,1,1-trifluoro-5-methoxy-4-methylpentan-3-amine has a molecular weight of 185.19 g/mol, XLogP of 1.55, 4 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (3S)-1,1,1-trifluoro-5-methoxy-4-methylpentan-3-amine is sourced from PubChem (CID 104941335), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).